C15H17N7O — CID 164948008
16-(methylamino)-2,6,14,15,18,20-hexazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one (PubChem CID 164948008) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is 16-(methylamino)-2,6,14,15,18,20-hexazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one.
| Compound Name | 16-(methylamino)-2,6,14,15,18,20-hexazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one |
|---|---|
| PubChem CID | 164948008 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 16-(methylamino)-2,6,14,15,18,20-hexazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)CCCCn1ccc(n1)N2 |
| InChI | InChI=1S/C15H17N7O/c1-16-14-8-13-18-12-5-7-21(20-12)6-3-2-4-11(23)10-9-17-22(14)15(10)19-13/h5,7-9,16H,2-4,6H2,1H3,(H,18,19,20) |
| InChIKey | CVZAKJPPTNJUDK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |