C13H15F3N2O5P+ — CID 164949115
methoxy-[(2-methylcinnolin-2-ium-4-yl)methyl]phosphinic acid;2,2,2-trifluoroacetic acid (PubChem CID 164949115) has the molecular formula C13H15F3N2O5P+ and a molecular weight of 367.24 g/mol. Its IUPAC name is methoxy-[(2-methylcinnolin-2-ium-4-yl)methyl]phosphinic acid;2,2,2-trifluoroacetic acid.
| Compound Name | methoxy-[(2-methylcinnolin-2-ium-4-yl)methyl]phosphinic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 164949115 |
| Molecular Formula | C13H15F3N2O5P+ |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | methoxy-[(2-methylcinnolin-2-ium-4-yl)methyl]phosphinic acid;2,2,2-trifluoroacetic acid |
| SMILES | COP(=O)(O)Cc1c[n+](C)nc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13N2O3P.C2HF3O2/c1-13-7-9(8-17(14,15)16-2)10-5-3-4-6-11(10)12-13;3-2(4,5)1(6)7/h3-7H,8H2,1-2H3;(H,6,7)/p+1 |
| InChIKey | CCXVFJOOXHPDMP-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|