C14H18ClN3O — CID 164951163
2-[(3aR,6aS)-2-(5-chloropyrazin-2-yl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetaldehyde (PubChem CID 164951163) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-[(3aR,6aS)-2-(5-chloropyrazin-2-yl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetaldehyde.
| Compound Name | 2-[(3aR,6aS)-2-(5-chloropyrazin-2-yl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 164951163 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[(3aR,6aS)-2-(5-chloropyrazin-2-yl)-5-methyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetaldehyde |
| SMILES | CC1(CC=O)C[C@H]2CN(c3cnc(Cl)cn3)C[C@H]2C1 |
| InChI | InChI=1S/C14H18ClN3O/c1-14(2-3-19)4-10-8-18(9-11(10)5-14)13-7-16-12(15)6-17-13/h3,6-7,10-11H,2,4-5,8-9H2,1H3/t10-,11+,14? |
| InChIKey | HDQSEBXZORINCS-BVUQATHDSA-N |
| XLogP | 2.57 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|