C23H30N3O4P — CID 164953263
1-[(2R,4R,5R)-4-[[(1R,3S,3aR)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyloxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one (PubChem CID 164953263) has the molecular formula C23H30N3O4P and a molecular weight of 443.48 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-4-[[(1R,3S,3aR)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyloxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,4R,5R)-4-[[(1R,3S,3aR)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyloxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 164953263 |
| Molecular Formula | C23H30N3O4P |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[(2R,4R,5R)-4-[[(1R,3S,3aR)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyloxolan-2-yl]-5-methyl-2-methylidenepyrimidin-4-one |
| SMILES | C=C1NC(=O)C(C)=CN1[C@H]1C[C@@H](O[P@@]2O[C@@H](c3ccccc3)[C@H]3CCCN32)[C@@H](CC)O1 |
| InChI | InChI=1S/C23H30N3O4P/c1-4-19-20(13-21(28-19)25-14-15(2)23(27)24-16(25)3)29-31-26-12-8-11-18(26)22(30-31)17-9-6-5-7-10-17/h5-7,9-10,14,18-22H,3-4,8,11-13H2,1-2H3,(H,24,27)/t18-,19-,20-,21-,22+,31+/m1/s1 |
| InChIKey | AUZFVAXLQYFLGN-VIVGZPBJSA-N |
| XLogP | 4.17 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|