C21H25FN3O5P — CID 157218473
1-[(2R,4S,5R)-4-[[(1S,3R,3aS)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyl-3-fluorooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 157218473) has the molecular formula C21H25FN3O5P and a molecular weight of 449.42 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[[(1S,3R,3aS)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyl-3-fluorooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[[(1S,3R,3aS)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyl-3-fluorooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157218473 |
| Molecular Formula | C21H25FN3O5P |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[[(1S,3R,3aS)-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]-5-ethyl-3-fluorooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(F)[C@H]1O[P@]1O[C@H](c2ccccc2)[C@@H]2CCCN21 |
| InChI | InChI=1S/C21H25FN3O5P/c1-2-15-19(17(22)20(28-15)24-12-10-16(26)23-21(24)27)30-31-25-11-6-9-14(25)18(29-31)13-7-4-3-5-8-13/h3-5,7-8,10,12,14-15,17-20H,2,6,9,11H2,1H3,(H,23,26,27)/t14-,15+,17?,18+,19-,20+,31-/m0/s1 |
| InChIKey | ASRSCJLFRVECIW-OYKLQFMZSA-N |
| XLogP | 3.03 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|