C26H36N2O3 — CID 164957374
(1-benzyl-4,4-dimethylazetidin-2-yl) formate;(1-benzyl-4,4-dimethylazetidin-2-yl)methanol (PubChem CID 164957374) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is (1-benzyl-4,4-dimethylazetidin-2-yl) formate;(1-benzyl-4,4-dimethylazetidin-2-yl)methanol.
| Compound Name | (1-benzyl-4,4-dimethylazetidin-2-yl) formate;(1-benzyl-4,4-dimethylazetidin-2-yl)methanol |
|---|---|
| PubChem CID | 164957374 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (1-benzyl-4,4-dimethylazetidin-2-yl) formate;(1-benzyl-4,4-dimethylazetidin-2-yl)methanol |
| SMILES | CC1(C)CC(CO)N1Cc1ccccc1.CC1(C)CC(OC=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO2.C13H19NO/c1-13(2)8-12(16-10-15)14(13)9-11-6-4-3-5-7-11;1-13(2)8-12(10-15)14(13)9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3;3-7,12,15H,8-10H2,1-2H3 |
| InChIKey | BIYMDAYEJWFTKY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|