C30H29ClF2N6O2S — CID 164960601
8-(5-chloro-2,4-difluorophenyl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-12-pyrazol-1-yl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one (PubChem CID 164960601) has the molecular formula C30H29ClF2N6O2S and a molecular weight of 611.12 g/mol. Its IUPAC name is 8-(5-chloro-2,4-difluorophenyl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-12-pyrazol-1-yl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one.
| Compound Name | 8-(5-chloro-2,4-difluorophenyl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-12-pyrazol-1-yl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 164960601 |
| Molecular Formula | C30H29ClF2N6O2S |
| Molecular Weight | 611.12 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | 8-(5-chloro-2,4-difluorophenyl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-12-pyrazol-1-yl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5cc(Cl)c(F)cc5F)c(C)cc24)SCC(n2cccn2)C3)C[C@@H]1C |
| InChI | InChI=1S/C30H29ClF2N6O2S/c1-5-25(40)39-17(3)12-36(13-18(39)4)29-21-9-16(2)26(20-10-22(31)24(33)11-23(20)32)28-27(21)37(30(41)35-29)14-19(15-42-28)38-8-6-7-34-38/h5-11,17-19H,1,12-15H2,2-4H3/t17-,18+,19? |
| InChIKey | BUBGCWASXJTGAJ-DFNIBXOVSA-N |
| XLogP | 5.46 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.12 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|