C31H37F2N5O3S — CID 165061456
8-(2,4-difluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one (PubChem CID 165061456) has the molecular formula C31H37F2N5O3S and a molecular weight of 597.73 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one.
| Compound Name | 8-(2,4-difluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 165061456 |
| Molecular Formula | C31H37F2N5O3S |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 8-(2,4-difluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(C)cc24)SCC(OCCN(C)C)C3)C[C@@H]1C |
| InChI | InChI=1S/C31H37F2N5O3S/c1-7-26(39)38-19(3)14-36(15-20(38)4)30-24-12-18(2)27(23-9-8-21(32)13-25(23)33)29-28(24)37(31(40)34-30)16-22(17-42-29)41-11-10-35(5)6/h7-9,12-13,19-20,22H,1,10-11,14-17H2,2-6H3/t19-,20+,22? |
| InChIKey | RFCQXFNXEHMKOT-RLAPIPATSA-N |
| XLogP | 4.31 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|