C30H33FN4O3S — CID 165095846
12-(cyclopropyloxymethyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(4-fluorophenyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 165095846) has the molecular formula C30H33FN4O3S and a molecular weight of 548.68 g/mol. Its IUPAC name is 12-(cyclopropyloxymethyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(4-fluorophenyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 12-(cyclopropyloxymethyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(4-fluorophenyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 165095846 |
| Molecular Formula | C30H33FN4O3S |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 12-(cyclopropyloxymethyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(4-fluorophenyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5)c(C)cc24)SCC3COC2CC2)C[C@@H]1C |
| InChI | InChI=1S/C30H33FN4O3S/c1-5-25(36)34-18(3)13-33(14-19(34)4)29-24-12-17(2)26(20-6-8-21(31)9-7-20)28-27(24)35(30(37)32-29)22(16-39-28)15-38-23-10-11-23/h5-9,12,18-19,22-23H,1,10-11,13-16H2,2-4H3/t18-,19+,22? |
| InChIKey | GMJULNZXHVCQJS-QIDMFYOTSA-N |
| XLogP | 4.95 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|