C31H32FN5O3S — CID 164980040
4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(5-fluoroisoquinolin-8-yl)-12-(methoxymethyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 164980040) has the molecular formula C31H32FN5O3S and a molecular weight of 573.69 g/mol. Its IUPAC name is 4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(5-fluoroisoquinolin-8-yl)-12-(methoxymethyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(5-fluoroisoquinolin-8-yl)-12-(methoxymethyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 164980040 |
| Molecular Formula | C31H32FN5O3S |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-8-(5-fluoroisoquinolin-8-yl)-12-(methoxymethyl)-7-methyl-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)c6ccncc56)c(C)cc24)SCC3COC)C[C@@H]1C |
| InChI | InChI=1S/C31H32FN5O3S/c1-6-26(38)36-18(3)13-35(14-19(36)4)30-23-11-17(2)27(22-7-8-25(32)21-9-10-33-12-24(21)22)29-28(23)37(31(39)34-30)20(15-40-5)16-41-29/h6-12,18-20H,1,13-16H2,2-5H3/t18-,19+,20? |
| InChIKey | LAPWKTORYQLVNA-YOFSQIOKSA-N |
| XLogP | 4.96 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|