C26H25ClF2N4O3S — CID 165041851
(12S)-8-(5-chloro-2,4-difluorophenyl)-12-(methoxymethyl)-7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 165041851) has the molecular formula C26H25ClF2N4O3S and a molecular weight of 547.03 g/mol. Its IUPAC name is (12S)-8-(5-chloro-2,4-difluorophenyl)-12-(methoxymethyl)-7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | (12S)-8-(5-chloro-2,4-difluorophenyl)-12-(methoxymethyl)-7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 165041851 |
| Molecular Formula | C26H25ClF2N4O3S |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | (12S)-8-(5-chloro-2,4-difluorophenyl)-12-(methoxymethyl)-7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5cc(Cl)c(F)cc5F)c(C)cc24)SC[C@@H]3COC)CC1 |
| InChI | InChI=1S/C26H25ClF2N4O3S/c1-4-21(34)31-5-7-32(8-6-31)25-17-9-14(2)22(16-10-18(27)20(29)11-19(16)28)24-23(17)33(26(35)30-25)15(12-36-3)13-37-24/h4,9-11,15H,1,5-8,12-13H2,2-3H3/t15-/m0/s1 |
| InChIKey | DEBWMPVRAVXMTG-HNNXBMFYSA-N |
| XLogP | 4.43 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|