C28H30N6O3S — CID 165020543
12-(methoxymethyl)-7-methyl-8-(6-methyl-1H-indazol-7-yl)-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 165020543) has the molecular formula C28H30N6O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is 12-(methoxymethyl)-7-methyl-8-(6-methyl-1H-indazol-7-yl)-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 12-(methoxymethyl)-7-methyl-8-(6-methyl-1H-indazol-7-yl)-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 165020543 |
| Molecular Formula | C28H30N6O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 12-(methoxymethyl)-7-methyl-8-(6-methyl-1H-indazol-7-yl)-4-(4-prop-2-enoylpiperazin-1-yl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5c(C)ccc6cn[nH]c56)c(C)cc24)SCC3COC)CC1 |
| InChI | InChI=1S/C28H30N6O3S/c1-5-21(35)32-8-10-33(11-9-32)27-20-12-17(3)23(22-16(2)6-7-18-13-29-31-24(18)22)26-25(20)34(28(36)30-27)19(14-37-4)15-38-26/h5-7,12-13,19H,1,8-11,14-15H2,2-4H3,(H,29,31) |
| InChIKey | PZOSTGGQPOHBIK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|