C40H44N6O5 — CID 164962924
3-[4-[4-[[4-[2-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]ethyl]phenyl]methyl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 164962924) has the molecular formula C40H44N6O5 and a molecular weight of 688.83 g/mol. Its IUPAC name is 3-[4-[4-[[4-[2-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]ethyl]phenyl]methyl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[[4-[2-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]ethyl]phenyl]methyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164962924 |
| Molecular Formula | C40H44N6O5 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.34 |
| IUPAC Name | 3-[4-[4-[[4-[2-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]ethyl]phenyl]methyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c3[nH]ncc23)cc(OC)c1CCc1ccc(CC2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C40H44N6O5/c1-45-24-33(32-23-41-44-38(32)40(45)49)28-21-35(50-2)31(36(22-28)51-3)13-8-25-4-6-26(7-5-25)20-27-16-18-46(19-17-27)30-11-9-29(10-12-30)42-34-14-15-37(47)43-39(34)48/h4-7,9-12,21-24,27,34,42H,8,13-20H2,1-3H3,(H,41,44)(H,43,47,48) |
| InChIKey | VHWQOBVQXIWPAP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|