C53H38N4Si — CID 164963232
[3-[2-(3-deuterio-6-methylcarbazol-9-yl)-6-(3,6-dideuteriocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane (PubChem CID 164963232) has the molecular formula C53H38N4Si and a molecular weight of 762.02 g/mol. Its IUPAC name is [3-[2-(3-deuterio-6-methylcarbazol-9-yl)-6-(3,6-dideuteriocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[2-(3-deuterio-6-methylcarbazol-9-yl)-6-(3,6-dideuteriocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 164963232 |
| Molecular Formula | C53H38N4Si |
| Molecular Weight | 762.02 g/mol |
| Exact Mass | 761.31 |
| IUPAC Name | [3-[2-(3-deuterio-6-methylcarbazol-9-yl)-6-(3,6-dideuteriocarbazol-9-yl)pyrimidin-4-yl]phenyl]-triphenylsilane |
| SMILES | [2H]c1ccc2c(c1)c1cc([2H])ccc1n2-c1cc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)nc(-n2c3ccc([2H])cc3c3cc(C)ccc32)n1 |
| InChI | InChI=1S/C53H38N4Si/c1-37-32-33-51-46(34-37)45-28-13-16-31-50(45)57(51)53-54-47(36-52(55-53)56-48-29-14-11-26-43(48)44-27-12-15-30-49(44)56)38-18-17-25-42(35-38)58(39-19-5-2-6-20-39,40-21-7-3-8-22-40)41-23-9-4-10-24-41/h2-36H,1H3/i11D,12D,13D |
| InChIKey | DDZURTQHHPOTHH-JZWBCEOFSA-N |
| XLogP | 10.02 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.02 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|