C55H42N4Si — CID 174181949
[3-[2,6-bis(3-methylcarbazol-9-yl)pyrimidin-4-yl]-5-methylphenyl]-triphenylsilane (PubChem CID 174181949) has the molecular formula C55H42N4Si and a molecular weight of 787.06 g/mol. Its IUPAC name is [3-[2,6-bis(3-methylcarbazol-9-yl)pyrimidin-4-yl]-5-methylphenyl]-triphenylsilane.
| Compound Name | [3-[2,6-bis(3-methylcarbazol-9-yl)pyrimidin-4-yl]-5-methylphenyl]-triphenylsilane |
|---|---|
| PubChem CID | 174181949 |
| Molecular Formula | C55H42N4Si |
| Molecular Weight | 787.06 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | [3-[2,6-bis(3-methylcarbazol-9-yl)pyrimidin-4-yl]-5-methylphenyl]-triphenylsilane |
| SMILES | Cc1cc(-c2cc(-n3c4ccccc4c4cc(C)ccc43)nc(-n3c4ccccc4c4cc(C)ccc43)n2)cc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C55H42N4Si/c1-37-27-29-52-47(33-37)45-23-13-15-25-50(45)58(52)54-36-49(56-55(57-54)59-51-26-16-14-24-46(51)48-34-38(2)28-30-53(48)59)40-31-39(3)32-44(35-40)60(41-17-7-4-8-18-41,42-19-9-5-10-20-42)43-21-11-6-12-22-43/h4-36H,1-3H3 |
| InChIKey | MBCSZUDQFHFZLP-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.06 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|