C38H46F3N5O5 — CID 164964337
3-[[4-[4-[1-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluorophenyl]methyl]piperidine-2,6-dione (PubChem CID 164964337) has the molecular formula C38H46F3N5O5 and a molecular weight of 709.81 g/mol. Its IUPAC name is 3-[[4-[4-[1-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluorophenyl]methyl]piperidine-2,6-dione.
| Compound Name | 3-[[4-[4-[1-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluorophenyl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164964337 |
| Molecular Formula | C38H46F3N5O5 |
| Molecular Weight | 709.81 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | 3-[[4-[4-[1-[[2,6-dimethoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluorophenyl]methyl]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c(C)c2C)cc(OC)c1CN1CCC(N2CCN(c3ccc(CC4CCC(=O)NC4=O)cc3F)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C38H46F3N5O5/c1-23-24(2)37(49)43(3)20-28(23)27-18-32(50-4)29(33(19-27)51-5)21-44-11-10-34(38(40,41)22-44)46-14-12-45(13-15-46)31-8-6-25(17-30(31)39)16-26-7-9-35(47)42-36(26)48/h6,8,17-20,26,34H,7,9-16,21-22H2,1-5H3,(H,42,47,48) |
| InChIKey | CGSFFCHYBIDCPX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|