C32H40F3N5O3 — CID 167379612
5-[4-[[(4S)-4-[4-(4-amino-2-fluorophenyl)piperazin-1-yl]-3,3-difluoropiperidin-1-yl]methyl]-3,5-dimethoxyphenyl]-1,3,4-trimethylpyridin-2-one (PubChem CID 167379612) has the molecular formula C32H40F3N5O3 and a molecular weight of 599.70 g/mol. Its IUPAC name is 5-[4-[[(4S)-4-[4-(4-amino-2-fluorophenyl)piperazin-1-yl]-3,3-difluoropiperidin-1-yl]methyl]-3,5-dimethoxyphenyl]-1,3,4-trimethylpyridin-2-one.
| Compound Name | 5-[4-[[(4S)-4-[4-(4-amino-2-fluorophenyl)piperazin-1-yl]-3,3-difluoropiperidin-1-yl]methyl]-3,5-dimethoxyphenyl]-1,3,4-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 167379612 |
| Molecular Formula | C32H40F3N5O3 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | 5-[4-[[(4S)-4-[4-(4-amino-2-fluorophenyl)piperazin-1-yl]-3,3-difluoropiperidin-1-yl]methyl]-3,5-dimethoxyphenyl]-1,3,4-trimethylpyridin-2-one |
| SMILES | COc1cc(-c2cn(C)c(=O)c(C)c2C)cc(OC)c1CN1CC[C@H](N2CCN(c3ccc(N)cc3F)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C32H40F3N5O3/c1-20-21(2)31(41)37(3)17-24(20)22-14-28(42-4)25(29(15-22)43-5)18-38-9-8-30(32(34,35)19-38)40-12-10-39(11-13-40)27-7-6-23(36)16-26(27)33/h6-7,14-17,30H,8-13,18-19,36H2,1-5H3/t30-/m0/s1 |
| InChIKey | UMEBTYYWDAVPGB-PMERELPUSA-N |
| XLogP | 4.44 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|