C56H87N5O15 — CID 164969158
[6-[[1,5-bis[[6-[3-(2-methoxyethoxy)propylamino]-3,6-dioxo-1-phenylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-6-oxohexyl] 5,5-diethoxypentanoate (PubChem CID 164969158) has the molecular formula C56H87N5O15 and a molecular weight of 1070.33 g/mol. Its IUPAC name is [6-[[1,5-bis[[6-[3-(2-methoxyethoxy)propylamino]-3,6-dioxo-1-phenylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-6-oxohexyl] 5,5-diethoxypentanoate.
| Compound Name | [6-[[1,5-bis[[6-[3-(2-methoxyethoxy)propylamino]-3,6-dioxo-1-phenylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-6-oxohexyl] 5,5-diethoxypentanoate |
|---|---|
| PubChem CID | 164969158 |
| Molecular Formula | C56H87N5O15 |
| Molecular Weight | 1070.33 g/mol |
| Exact Mass | 1069.62 |
| IUPAC Name | [6-[[1,5-bis[[6-[3-(2-methoxyethoxy)propylamino]-3,6-dioxo-1-phenylhexan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-6-oxohexyl] 5,5-diethoxypentanoate |
| SMILES | CCOC(CCCC(=O)OCCCCCC(=O)NC(CCC(=O)NC(Cc1ccccc1)C(=O)CCC(=O)NCCCOCCOC)C(=O)NC(Cc1ccccc1)C(=O)CCC(=O)NCCCOCCOC)OCC |
| InChI | InChI=1S/C56H87N5O15/c1-5-74-55(75-6-2)25-16-24-54(68)76-36-15-9-14-23-52(66)59-45(56(69)61-47(42-44-21-12-8-13-22-44)49(63)28-31-51(65)58-33-18-35-73-40-38-71-4)26-29-53(67)60-46(41-43-19-10-7-11-20-43)48(62)27-30-50(64)57-32-17-34-72-39-37-70-3/h7-8,10-13,19-22,45-47,55H,5-6,9,14-18,23-42H2,1-4H3,(H,57,64)(H,58,65)(H,59,66)(H,60,67)(H,61,69) |
| InChIKey | BKHGYUACJUHTPN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 261.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|