C27H42N5O2S+ — CID 164970618
5-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)pentyl-dimethyl-[2-(3-methylsulfanyl-3-oxopropoxy)ethyl]azanium (PubChem CID 164970618) has the molecular formula C27H42N5O2S+ and a molecular weight of 500.73 g/mol. Its IUPAC name is 5-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)pentyl-dimethyl-[2-(3-methylsulfanyl-3-oxopropoxy)ethyl]azanium.
| Compound Name | 5-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)pentyl-dimethyl-[2-(3-methylsulfanyl-3-oxopropoxy)ethyl]azanium |
|---|---|
| PubChem CID | 164970618 |
| Molecular Formula | C27H42N5O2S+ |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 5-(4-amino-2-butyl-3H-imidazo[4,5-c]quinolin-8-yl)pentyl-dimethyl-[2-(3-methylsulfanyl-3-oxopropoxy)ethyl]azanium |
| SMILES | CCCCc1nc2c([nH]1)c(N)nc1ccc(CCCCC[N+](C)(C)CCOCCC(=O)SC)cc12 |
| InChI | InChI=1S/C27H42N5O2S/c1-5-6-11-23-30-25-21-19-20(12-13-22(21)29-27(28)26(25)31-23)10-8-7-9-15-32(2,3)16-18-34-17-14-24(33)35-4/h12-13,19H,5-11,14-18H2,1-4H3,(H2,28,29)(H,30,31)/q+1 |
| InChIKey | CEGCAHMNLZMVJC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|