C21H23N5 — CID 164926397
7-[(4-aminophenyl)methyl]-2-butyl-3H-imidazo[4,5-c]quinolin-4-amine (PubChem CID 164926397) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is 7-[(4-aminophenyl)methyl]-2-butyl-3H-imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 7-[(4-aminophenyl)methyl]-2-butyl-3H-imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 164926397 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 7-[(4-aminophenyl)methyl]-2-butyl-3H-imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c([nH]1)c(N)nc1cc(Cc3ccc(N)cc3)ccc12 |
| InChI | InChI=1S/C21H23N5/c1-2-3-4-18-25-19-16-10-7-14(11-13-5-8-15(22)9-6-13)12-17(16)24-21(23)20(19)26-18/h5-10,12H,2-4,11,22H2,1H3,(H2,23,24)(H,25,26) |
| InChIKey | UEHZKLBPDFHREA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|