C19H28N4O2 — CID 170766292
2-butyl-N,7-dimethyl-3H-imidazo[4,5-c]quinolin-4-amine;ethane;formic acid (PubChem CID 170766292) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-butyl-N,7-dimethyl-3H-imidazo[4,5-c]quinolin-4-amine;ethane;formic acid.
| Compound Name | 2-butyl-N,7-dimethyl-3H-imidazo[4,5-c]quinolin-4-amine;ethane;formic acid |
|---|---|
| PubChem CID | 170766292 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-butyl-N,7-dimethyl-3H-imidazo[4,5-c]quinolin-4-amine;ethane;formic acid |
| SMILES | CC.CCCCc1nc2c([nH]1)c(NC)nc1cc(C)ccc12.O=CO |
| InChI | InChI=1S/C16H20N4.C2H6.CH2O2/c1-4-5-6-13-19-14-11-8-7-10(2)9-12(11)18-16(17-3)15(14)20-13;1-2;2-1-3/h7-9H,4-6H2,1-3H3,(H,17,18)(H,19,20);1-2H3;1H,(H,2,3) |
| InChIKey | OVSKPCXAJQURCD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|