C16H18N4O2 — CID 67837140
5-benzyl-2-butyl-3,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione (PubChem CID 67837140) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-benzyl-2-butyl-3,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione.
| Compound Name | 5-benzyl-2-butyl-3,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione |
|---|---|
| PubChem CID | 67837140 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-benzyl-2-butyl-3,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione |
| SMILES | CCCCc1nc2c(=O)[nH]n(Cc3ccccc3)c(=O)c2[nH]1 |
| InChI | InChI=1S/C16H18N4O2/c1-2-3-9-12-17-13-14(18-12)16(22)20(19-15(13)21)10-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,17,18)(H,19,21) |
| InChIKey | CTUXHYNTTBUZGL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |