C28H39N5O2S — CID 170766160
2-butyl-4-(methylamino)-1-[3-(phenylsulfanylamino)propyl]imidazo[4,5-c]quinoline-7-carbaldehyde;ethane;methanol (PubChem CID 170766160) has the molecular formula C28H39N5O2S and a molecular weight of 509.72 g/mol. Its IUPAC name is 2-butyl-4-(methylamino)-1-[3-(phenylsulfanylamino)propyl]imidazo[4,5-c]quinoline-7-carbaldehyde;ethane;methanol.
| Compound Name | 2-butyl-4-(methylamino)-1-[3-(phenylsulfanylamino)propyl]imidazo[4,5-c]quinoline-7-carbaldehyde;ethane;methanol |
|---|---|
| PubChem CID | 170766160 |
| Molecular Formula | C28H39N5O2S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 2-butyl-4-(methylamino)-1-[3-(phenylsulfanylamino)propyl]imidazo[4,5-c]quinoline-7-carbaldehyde;ethane;methanol |
| SMILES | CC.CCCCc1nc2c(NC)nc3cc(C=O)ccc3c2n1CCCNSc1ccccc1.CO |
| InChI | InChI=1S/C25H29N5OS.C2H6.CH4O/c1-3-4-11-22-29-23-24(20-13-12-18(17-31)16-21(20)28-25(23)26-2)30(22)15-8-14-27-32-19-9-6-5-7-10-19;2*1-2/h5-7,9-10,12-13,16-17,27H,3-4,8,11,14-15H2,1-2H3,(H,26,28);1-2H3;2H,1H3 |
| InChIKey | UTKJWKPKFVLEOM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|