C24H35N5O2 — CID 170766247
methyl 2-butyl-1-[5-(dimethylamino)pentyl]-4-(methylamino)imidazo[4,5-c]quinoline-7-carboxylate (PubChem CID 170766247) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is methyl 2-butyl-1-[5-(dimethylamino)pentyl]-4-(methylamino)imidazo[4,5-c]quinoline-7-carboxylate.
| Compound Name | methyl 2-butyl-1-[5-(dimethylamino)pentyl]-4-(methylamino)imidazo[4,5-c]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 170766247 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | methyl 2-butyl-1-[5-(dimethylamino)pentyl]-4-(methylamino)imidazo[4,5-c]quinoline-7-carboxylate |
| SMILES | CCCCc1nc2c(NC)nc3cc(C(=O)OC)ccc3c2n1CCCCCN(C)C |
| InChI | InChI=1S/C24H35N5O2/c1-6-7-11-20-27-21-22(29(20)15-10-8-9-14-28(3)4)18-13-12-17(24(30)31-5)16-19(18)26-23(21)25-2/h12-13,16H,6-11,14-15H2,1-5H3,(H,25,26) |
| InChIKey | QOMGYIAXYAXDCX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|