About 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol
3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol (PubChem CID 138607621) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol.
Molecular Properties
| Compound Name | 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol |
| PubChem CID | 138607621 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol |
| SMILES | Nc1nc2cc(-c3cccc(O)c3)ccc2c2nc(CCCO)[nH]c12 |
| InChI | InChI=1S/C19H18N4O2/c20-19-18-17(22-16(23-18)5-2-8-24)14-7-6-12(10-15(14)21-19)11-3-1-4-13(25)9-11/h1,3-4,6-7,9-10,24-25H,2,5,8H2,(H2,20,21)(H,22,23) |
| InChIKey | IZBRBTSQRLYNBD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol?
The IUPAC name of 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol (CID 138607621) is 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol.
What is the SMILES notation for 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol?
The canonical SMILES for 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol is Nc1nc2cc(-c3cccc(O)c3)ccc2c2nc(CCCO)[nH]c12.
What is the InChIKey of 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol?
The InChIKey is IZBRBTSQRLYNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c20-19-18-17(22-16(23-18)5-2-8-24)14-7-6-12(10-15(14)21-19)11-3-1-4-13(25)9-11/h1,3-4,6-7,9-10,24-25H,2,5,8H2,(H2,20,21)(H,22,23).
What are the key properties of 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol?
3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol has a molecular weight of 334.38 g/mol, XLogP of 2.99, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-amino-2-(3-hydroxypropyl)-3H-imidazo[4,5-c]quinolin-7-yl]phenol is sourced from PubChem (CID 138607621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).