C22H34O7 — CID 164970685
4-O-[2-[3-ethyl-6-hydroxy-3-(3-hydroxypropyl)hexoxy]ethyl] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 164970685) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-O-[2-[3-ethyl-6-hydroxy-3-(3-hydroxypropyl)hexoxy]ethyl] 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[3-ethyl-6-hydroxy-3-(3-hydroxypropyl)hexoxy]ethyl] 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 164970685 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-O-[2-[3-ethyl-6-hydroxy-3-(3-hydroxypropyl)hexoxy]ethyl] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | CCC(CCCO)(CCCO)CCOCCOC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C22H34O7/c1-3-22(10-4-13-23,11-5-14-24)12-15-28-16-17-29-21(26)19-8-6-18(7-9-19)20(25)27-2/h6-9,23-24H,3-5,10-17H2,1-2H3 |
| InChIKey | DBUHPDUBPMIWPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|