C40H49ClN7O7P — CID 164973099
4-[10-[(3R)-3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxodecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 164973099) has the molecular formula C40H49ClN7O7P and a molecular weight of 806.30 g/mol. Its IUPAC name is 4-[10-[(3R)-3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxodecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[10-[(3R)-3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxodecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 164973099 |
| Molecular Formula | C40H49ClN7O7P |
| Molecular Weight | 806.30 g/mol |
| Exact Mass | 805.31 |
| IUPAC Name | 4-[10-[(3R)-3-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxodecoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(N[C@@H]2CCCN(CCCCCCCCC(=O)COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)ncc1Cl |
| InChI | InChI=1S/C40H49ClN7O7P/c1-56(2,54)33-18-9-8-16-30(33)44-36-29(41)23-42-40(46-36)43-26-13-12-22-47(24-26)21-10-6-4-3-5-7-14-27(49)25-55-32-17-11-15-28-35(32)39(53)48(38(28)52)31-19-20-34(50)45-37(31)51/h8-9,11,15-18,23,26,31H,3-7,10,12-14,19-22,24-25H2,1-2H3,(H,45,50,51)(H2,42,43,44,46)/t26-,31?/m1/s1 |
| InChIKey | PCUPRXBORPANJJ-SYQKMTEESA-N |
| XLogP | 5.78 |
| TPSA | 180.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|