C12H21N — CID 164973238
(2R)-N-[1-(1-bicyclo[1.1.1]pentanyl)ethenyl]-3-methylbutan-2-amine (PubChem CID 164973238) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2R)-N-[1-(1-bicyclo[1.1.1]pentanyl)ethenyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-N-[1-(1-bicyclo[1.1.1]pentanyl)ethenyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 164973238 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2R)-N-[1-(1-bicyclo[1.1.1]pentanyl)ethenyl]-3-methylbutan-2-amine |
| SMILES | C=C(N[C@H](C)C(C)C)C12CC(C1)C2 |
| InChI | InChI=1S/C12H21N/c1-8(2)9(3)13-10(4)12-5-11(6-12)7-12/h8-9,11,13H,4-7H2,1-3H3/t9-,11?,12?/m1/s1 |
| InChIKey | DPJKBGCKRLBLIM-OIKLOGQESA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |