C13H20F3N — CID 164984309
(2R)-3-methyl-N-[1-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]ethenyl]butan-2-amine (PubChem CID 164984309) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (2R)-3-methyl-N-[1-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]ethenyl]butan-2-amine.
| Compound Name | (2R)-3-methyl-N-[1-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]ethenyl]butan-2-amine |
|---|---|
| PubChem CID | 164984309 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (2R)-3-methyl-N-[1-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]ethenyl]butan-2-amine |
| SMILES | C=C(N[C@H](C)C(C)C)C12CC(C(F)(F)F)(C1)C2 |
| InChI | InChI=1S/C13H20F3N/c1-8(2)9(3)17-10(4)11-5-12(6-11,7-11)13(14,15)16/h8-9,17H,4-7H2,1-3H3/t9-,11?,12?/m1/s1 |
| InChIKey | OTGPVAJNXGUSKB-OIKLOGQESA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |