C48H31NOS — CID 164973324
4-(9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaen-18-yl)-N,N-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 164973324) has the molecular formula C48H31NOS and a molecular weight of 679.91 g/mol. Its IUPAC name is 4-(9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaen-18-yl)-N,N-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 4-(9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaen-18-yl)-N,N-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 164973324 |
| Molecular Formula | C48H31NOS |
| Molecular Weight | 679.91 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | 4-(9-oxa-20-thiapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaen-18-yl)-N,N-bis[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])cc3)c3ccc(-c4cccc5c4sc4c5ccc5oc6ccccc6c54)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H31NOS/c1-3-10-32(11-4-1)34-18-24-37(25-19-34)49(38-26-20-35(21-27-38)33-12-5-2-6-13-33)39-28-22-36(23-29-39)40-15-9-16-41-42-30-31-45-46(48(42)51-47(40)41)43-14-7-8-17-44(43)50-45/h1-31H/i1D,2D,3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | WIMKMFNWQTUHCB-KJIKOLQBSA-N |
| XLogP | 14.42 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.91 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |