C52H33NOS — CID 177130752
11-dibenzothiophen-4-yl-N,N-bis[3,5-dideuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-4-amine (PubChem CID 177130752) has the molecular formula C52H33NOS and a molecular weight of 733.99 g/mol. Its IUPAC name is 11-dibenzothiophen-4-yl-N,N-bis[3,5-dideuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-4-amine.
| Compound Name | 11-dibenzothiophen-4-yl-N,N-bis[3,5-dideuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-4-amine |
|---|---|
| PubChem CID | 177130752 |
| Molecular Formula | C52H33NOS |
| Molecular Weight | 733.99 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | 11-dibenzothiophen-4-yl-N,N-bis[3,5-dideuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]naphtho[2,1-b][1]benzofuran-4-amine |
| SMILES | [2H]c1cc(N(c2cc([2H])c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c([2H])c2)c2cccc3c2ccc2oc4cccc(-c5cccc6c5sc5ccccc56)c4c23)cc([2H])c1-c1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C52H33NOS/c1-3-12-34(13-4-1)36-24-28-38(29-25-36)53(39-30-26-37(27-31-39)35-14-5-2-6-15-35)46-21-10-17-42-40(46)32-33-48-50(42)51-43(18-11-22-47(51)54-48)45-20-9-19-44-41-16-7-8-23-49(41)55-52(44)45/h1-33H/i1D,2D,3D,4D,5D,6D,12D,13D,14D,15D,24D,25D,26D,27D |
| InChIKey | HKACOUOFUPGKBM-WPTDZYPQSA-N |
| XLogP | 15.58 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.99 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |