C19H19BrFN5O — CID 164974430
5-(8-bromo-6-fluoro-2-piperidin-1-ylquinazolin-4-yl)-2-methoxypyridin-3-amine (PubChem CID 164974430) has the molecular formula C19H19BrFN5O and a molecular weight of 432.30 g/mol. Its IUPAC name is 5-(8-bromo-6-fluoro-2-piperidin-1-ylquinazolin-4-yl)-2-methoxypyridin-3-amine.
| Compound Name | 5-(8-bromo-6-fluoro-2-piperidin-1-ylquinazolin-4-yl)-2-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 164974430 |
| Molecular Formula | C19H19BrFN5O |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 5-(8-bromo-6-fluoro-2-piperidin-1-ylquinazolin-4-yl)-2-methoxypyridin-3-amine |
| SMILES | COc1ncc(-c2nc(N3CCCCC3)nc3c(Br)cc(F)cc23)cc1N |
| InChI | InChI=1S/C19H19BrFN5O/c1-27-18-15(22)7-11(10-23-18)16-13-8-12(21)9-14(20)17(13)25-19(24-16)26-5-3-2-4-6-26/h7-10H,2-6,22H2,1H3 |
| InChIKey | LLSORXAQGXCCGR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |