C18H22N2O3 — CID 164976966
(2S)-2-amino-2-phenylacetamide;1-(4-methoxyphenyl)propan-2-one (PubChem CID 164976966) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2S)-2-amino-2-phenylacetamide;1-(4-methoxyphenyl)propan-2-one.
| Compound Name | (2S)-2-amino-2-phenylacetamide;1-(4-methoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 164976966 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2S)-2-amino-2-phenylacetamide;1-(4-methoxyphenyl)propan-2-one |
| SMILES | COc1ccc(CC(C)=O)cc1.NC(=O)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C10H12O2.C8H10N2O/c1-8(11)7-9-3-5-10(12-2)6-4-9;9-7(8(10)11)6-4-2-1-3-5-6/h3-6H,7H2,1-2H3;1-5,7H,9H2,(H2,10,11)/t;7-/m.0/s1 |
| InChIKey | DXSNMCIUBAXRKE-ZLTKDMPESA-N |
| XLogP | 2.00 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |