C37H35F3O5 — CID 164979341
5-[4-[2-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(3,4,5-trimethylphenyl)ethyl]phenyl]acetyl]phenoxy]-2-propanoylbenzoic acid (PubChem CID 164979341) has the molecular formula C37H35F3O5 and a molecular weight of 616.68 g/mol. Its IUPAC name is 5-[4-[2-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(3,4,5-trimethylphenyl)ethyl]phenyl]acetyl]phenoxy]-2-propanoylbenzoic acid.
| Compound Name | 5-[4-[2-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(3,4,5-trimethylphenyl)ethyl]phenyl]acetyl]phenoxy]-2-propanoylbenzoic acid |
|---|---|
| PubChem CID | 164979341 |
| Molecular Formula | C37H35F3O5 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 5-[4-[2-[2,6-dimethyl-4-[2,2,2-trifluoro-1-(3,4,5-trimethylphenyl)ethyl]phenyl]acetyl]phenoxy]-2-propanoylbenzoic acid |
| SMILES | CCC(=O)c1ccc(Oc2ccc(C(=O)Cc3c(C)cc(C(c4cc(C)c(C)c(C)c4)C(F)(F)F)cc3C)cc2)cc1C(=O)O |
| InChI | InChI=1S/C37H35F3O5/c1-7-33(41)30-13-12-29(18-32(30)36(43)44)45-28-10-8-25(9-11-28)34(42)19-31-22(4)16-27(17-23(31)5)35(37(38,39)40)26-14-20(2)24(6)21(3)15-26/h8-18,35H,7,19H2,1-6H3,(H,43,44) |
| InChIKey | FOOBHNYVHGZRBN-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |