C37H32F6O4 — CID 165077120
5-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]acetyl]phenyl]propan-2-yl]-2-propanoylbenzoic acid (PubChem CID 165077120) has the molecular formula C37H32F6O4 and a molecular weight of 654.65 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]acetyl]phenyl]propan-2-yl]-2-propanoylbenzoic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]acetyl]phenyl]propan-2-yl]-2-propanoylbenzoic acid |
|---|---|
| PubChem CID | 165077120 |
| Molecular Formula | C37H32F6O4 |
| Molecular Weight | 654.65 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]acetyl]phenyl]propan-2-yl]-2-propanoylbenzoic acid |
| SMILES | CCC(=O)c1ccc(C(c2ccc(C(=O)Cc3ccc(C(C)(C)c4ccc(C)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C37H32F6O4/c1-5-31(44)29-19-18-28(21-30(29)33(46)47)35(36(38,39)40,37(41,42)43)27-16-10-24(11-17-27)32(45)20-23-8-14-26(15-9-23)34(3,4)25-12-6-22(2)7-13-25/h6-19,21H,5,20H2,1-4H3,(H,46,47) |
| InChIKey | CYOIXJWRXFGJHR-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.65 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |