C14H24N2O2 — CID 164981371
butyl 4-cyano-3-propan-2-ylpiperidine-1-carboxylate (PubChem CID 164981371) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is butyl 4-cyano-3-propan-2-ylpiperidine-1-carboxylate.
| Compound Name | butyl 4-cyano-3-propan-2-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164981371 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | butyl 4-cyano-3-propan-2-ylpiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(C#N)C(C(C)C)C1 |
| InChI | InChI=1S/C14H24N2O2/c1-4-5-8-18-14(17)16-7-6-12(9-15)13(10-16)11(2)3/h11-13H,4-8,10H2,1-3H3 |
| InChIKey | FPMOGUQFBZJLHM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|