C9H13FN2O2 — CID 105452685
ethyl (3S,4S)-4-cyano-3-fluoropiperidine-1-carboxylate (PubChem CID 105452685) has the molecular formula C9H13FN2O2 and a molecular weight of 200.21 g/mol. Its IUPAC name is ethyl (3S,4S)-4-cyano-3-fluoropiperidine-1-carboxylate.
| Compound Name | ethyl (3S,4S)-4-cyano-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 105452685 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl (3S,4S)-4-cyano-3-fluoropiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H](C#N)[C@H](F)C1 |
| InChI | InChI=1S/C9H13FN2O2/c1-2-14-9(13)12-4-3-7(5-11)8(10)6-12/h7-8H,2-4,6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | DNNORQCNOONTNO-JGVFFNPUSA-N |
| XLogP | 1.33 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |