C10H19FN4O3 — CID 58902813
ethyl 3-fluoro-4-[(hydrazinecarbonylamino)methyl]piperidine-1-carboxylate (PubChem CID 58902813) has the molecular formula C10H19FN4O3 and a molecular weight of 262.28 g/mol. Its IUPAC name is ethyl 3-fluoro-4-[(hydrazinecarbonylamino)methyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-fluoro-4-[(hydrazinecarbonylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58902813 |
| Molecular Formula | C10H19FN4O3 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl 3-fluoro-4-[(hydrazinecarbonylamino)methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(CNC(=O)NN)C(F)C1 |
| InChI | InChI=1S/C10H19FN4O3/c1-2-18-10(17)15-4-3-7(8(11)6-15)5-13-9(16)14-12/h7-8H,2-6,12H2,1H3,(H2,13,14,16) |
| InChIKey | DCNLQNNTYZCRAL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|