C16H23FN4O2S — CID 131727639
(4-methylphenyl)methyl (3S,4R)-4-[(aminocarbamothioylamino)methyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 131727639) has the molecular formula C16H23FN4O2S and a molecular weight of 354.45 g/mol. Its IUPAC name is (4-methylphenyl)methyl (3S,4R)-4-[(aminocarbamothioylamino)methyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | (4-methylphenyl)methyl (3S,4R)-4-[(aminocarbamothioylamino)methyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 131727639 |
| Molecular Formula | C16H23FN4O2S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (4-methylphenyl)methyl (3S,4R)-4-[(aminocarbamothioylamino)methyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | Cc1ccc(COC(=O)N2CC[C@H](CNC(=S)NN)[C@H](F)C2)cc1 |
| InChI | InChI=1S/C16H23FN4O2S/c1-11-2-4-12(5-3-11)10-23-16(22)21-7-6-13(14(17)9-21)8-19-15(24)20-18/h2-5,13-14H,6-10,18H2,1H3,(H2,19,20,24)/t13-,14-/m1/s1 |
| InChIKey | CKUDCBBQWMXCPC-ZIAGYGMSSA-N |
| XLogP | 1.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|