C15H22ClFN2O2 — CID 121415318
(4-methylphenyl)methyl 4-(aminomethyl)-3-fluoropiperidine-1-carboxylate;hydrochloride (PubChem CID 121415318) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is (4-methylphenyl)methyl 4-(aminomethyl)-3-fluoropiperidine-1-carboxylate;hydrochloride.
| Compound Name | (4-methylphenyl)methyl 4-(aminomethyl)-3-fluoropiperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 121415318 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (4-methylphenyl)methyl 4-(aminomethyl)-3-fluoropiperidine-1-carboxylate;hydrochloride |
| SMILES | Cc1ccc(COC(=O)N2CCC(CN)C(F)C2)cc1.Cl |
| InChI | InChI=1S/C15H21FN2O2.ClH/c1-11-2-4-12(5-3-11)10-20-15(19)18-7-6-13(8-17)14(16)9-18;/h2-5,13-14H,6-10,17H2,1H3;1H |
| InChIKey | RWZXNHFZUFATJA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |