C14H24N2O2 — CID 167115899
3,3-dimethylbutyl 4-cyano-3-methylpiperidine-1-carboxylate (PubChem CID 167115899) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 3,3-dimethylbutyl 4-cyano-3-methylpiperidine-1-carboxylate.
| Compound Name | 3,3-dimethylbutyl 4-cyano-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167115899 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 3,3-dimethylbutyl 4-cyano-3-methylpiperidine-1-carboxylate |
| SMILES | CC1CN(C(=O)OCCC(C)(C)C)CCC1C#N |
| InChI | InChI=1S/C14H24N2O2/c1-11-10-16(7-5-12(11)9-15)13(17)18-8-6-14(2,3)4/h11-12H,5-8,10H2,1-4H3 |
| InChIKey | KBPPXHHDCBACDS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |