C17H22N2O2 — CID 167115825
3-phenylpropyl 3-cyano-4-methylpiperidine-1-carboxylate (PubChem CID 167115825) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-phenylpropyl 3-cyano-4-methylpiperidine-1-carboxylate.
| Compound Name | 3-phenylpropyl 3-cyano-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167115825 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-phenylpropyl 3-cyano-4-methylpiperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OCCCc2ccccc2)CC1C#N |
| InChI | InChI=1S/C17H22N2O2/c1-14-9-10-19(13-16(14)12-18)17(20)21-11-5-8-15-6-3-2-4-7-15/h2-4,6-7,14,16H,5,8-11,13H2,1H3 |
| InChIKey | APVWLIRDBJDLNA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|