benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate

C19H18N2O2 — CID 66510827

IUPACbenzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate
SMILESN#C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H]1c1ccccc1
InChIInChI=1S/C19H18N2O2/c20-11-17-12-21(13-18(17)16-9-5-2-6-10-16)19(22)23-14-15-7-3-1-4-8-15/h1-10,17-18H,12-14H2/t17-,18+/m1/s1
InChIKeyKALJZSZFDJGXBH-MSOLQXFVSA-N
MW306.37 g/mol
LogP3.56
Rot. Bonds3

About benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate

benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate (PubChem CID 66510827) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate
PubChem CID66510827
Molecular FormulaC19H18N2O2
Molecular Weight306.37 g/mol
Exact Mass306.14
IUPAC Namebenzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate
SMILESN#C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H]1c1ccccc1
InChIInChI=1S/C19H18N2O2/c20-11-17-12-21(13-18(17)16-9-5-2-6-10-16)19(22)23-14-15-7-3-1-4-8-15/h1-10,17-18H,12-14H2/t17-,18+/m1/s1
InChIKeyKALJZSZFDJGXBH-MSOLQXFVSA-N
XLogP3.56
TPSA53.33 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.37
LogP ≤ 53.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate?
The IUPAC name of benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate (CID 66510827) is benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate is N#C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H]1c1ccccc1.
What is the InChIKey of benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate?
The InChIKey is KALJZSZFDJGXBH-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H18N2O2/c20-11-17-12-21(13-18(17)16-9-5-2-6-10-16)19(22)23-14-15-7-3-1-4-8-15/h1-10,17-18H,12-14H2/t17-,18+/m1/s1.
What are the key properties of benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate?
benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate has a molecular weight of 306.37 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate is sourced from PubChem (CID 66510827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).