C19H18N2O2 — CID 66510827
benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate (PubChem CID 66510827) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66510827 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | benzyl (3S,4R)-3-cyano-4-phenylpyrrolidine-1-carboxylate |
| SMILES | N#C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c20-11-17-12-21(13-18(17)16-9-5-2-6-10-16)19(22)23-14-15-7-3-1-4-8-15/h1-10,17-18H,12-14H2/t17-,18+/m1/s1 |
| InChIKey | KALJZSZFDJGXBH-MSOLQXFVSA-N |
| XLogP | 3.56 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |