C70H91BNO19S — CID 164982145
CID 164982145 (PubChem CID 164982145) has the molecular formula C70H91BNO19S and a molecular weight of 1295.37 g/mol.
| Compound Name | CID 164982145 |
|---|---|
| PubChem CID | 164982145 |
| Molecular Formula | C70H91BNO19S |
| Molecular Weight | 1295.37 g/mol |
| Exact Mass | 1294.61 |
| IUPAC Name | — |
| SMILES | [3H]OCC1CC(=C)CN1C(=O)c1cc(C)c(OCc2cc(COc3cc(CC(=O)Oc4ccc(C(=O)CCCOC)c(O[C@@H]5O[C@H](C)C(C)[C@H](C)C5OC)c4)c(C(=O)C4CC(=C)C[C@H]4CC)cc3OC)cc(OCCOCCOCCOCC(=O)OC)c2)cc1C.[B]=S |
| InChI | InChI=1S/C70H91NO19.BS/c1-13-51-25-42(2)27-58(51)67(76)59-36-63(79-10)64(33-52(59)34-65(74)89-54-16-17-56(60(73)15-14-18-78-9)62(35-54)90-70-68(81-12)47(7)46(6)48(8)88-70)87-40-50-30-49(31-55(32-50)85-24-23-83-20-19-82-21-22-84-41-66(75)80-11)39-86-61-29-44(4)57(28-45(61)5)69(77)71-37-43(3)26-53(71)38-72;1-2/h16-17,28-33,35-36,46-48,51,53,58,68,70,72H,2-3,13-15,18-27,34,37-41H2,1,4-12H3;/t46?,47-,48+,51+,53?,58?,68?,70-;/m0./s1/i72T; |
| InChIKey | BLGFJGAPDQKHEB-NOFQHIDBSA-N |
| XLogP | 10.45 |
| TPSA | 228.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1295.37 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|