C16H19NOS — CID 164982494
(4S)-4-(methylamino)-4-[4-(3-methylthiophen-2-yl)phenyl]butan-2-one (PubChem CID 164982494) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is (4S)-4-(methylamino)-4-[4-(3-methylthiophen-2-yl)phenyl]butan-2-one.
| Compound Name | (4S)-4-(methylamino)-4-[4-(3-methylthiophen-2-yl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 164982494 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (4S)-4-(methylamino)-4-[4-(3-methylthiophen-2-yl)phenyl]butan-2-one |
| SMILES | CN[C@@H](CC(C)=O)c1ccc(-c2sccc2C)cc1 |
| InChI | InChI=1S/C16H19NOS/c1-11-8-9-19-16(11)14-6-4-13(5-7-14)15(17-3)10-12(2)18/h4-9,15,17H,10H2,1-3H3/t15-/m0/s1 |
| InChIKey | HHSYIRVOLXLDCS-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |