C60H46O8S2 — CID 134251566
methyl 4-[4,5-bis[4-(formyloxymethyl)phenyl]-2-(4-methoxycarbonylphenyl)-3,6-bis[4-(3-methylthiophen-2-yl)phenyl]phenyl]benzoate (PubChem CID 134251566) has the molecular formula C60H46O8S2 and a molecular weight of 959.15 g/mol. Its IUPAC name is methyl 4-[4,5-bis[4-(formyloxymethyl)phenyl]-2-(4-methoxycarbonylphenyl)-3,6-bis[4-(3-methylthiophen-2-yl)phenyl]phenyl]benzoate.
| Compound Name | methyl 4-[4,5-bis[4-(formyloxymethyl)phenyl]-2-(4-methoxycarbonylphenyl)-3,6-bis[4-(3-methylthiophen-2-yl)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 134251566 |
| Molecular Formula | C60H46O8S2 |
| Molecular Weight | 959.15 g/mol |
| Exact Mass | 958.26 |
| IUPAC Name | methyl 4-[4,5-bis[4-(formyloxymethyl)phenyl]-2-(4-methoxycarbonylphenyl)-3,6-bis[4-(3-methylthiophen-2-yl)phenyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c(-c3ccc(C(=O)OC)cc3)c(-c3ccc(-c4sccc4C)cc3)c(-c3ccc(COC=O)cc3)c(-c3ccc(COC=O)cc3)c2-c2ccc(-c3sccc3C)cc2)cc1 |
| InChI | InChI=1S/C60H46O8S2/c1-37-29-31-69-57(37)47-21-13-43(14-22-47)53-51(41-9-5-39(6-10-41)33-67-35-61)52(42-11-7-40(8-12-42)34-68-36-62)54(44-15-23-48(24-16-44)58-38(2)30-32-70-58)56(46-19-27-50(28-20-46)60(64)66-4)55(53)45-17-25-49(26-18-45)59(63)65-3/h5-32,35-36H,33-34H2,1-4H3 |
| InChIKey | OUPFJOGVQBQMRS-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.15 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|