C24H26N2O6 — CID 156624697
methyl 4-[[(1S,3R)-3-[[4-(formyloxymethyl)phenyl]carbamoyl]cyclohexanecarbonyl]amino]benzoate (PubChem CID 156624697) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 4-[[(1S,3R)-3-[[4-(formyloxymethyl)phenyl]carbamoyl]cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(1S,3R)-3-[[4-(formyloxymethyl)phenyl]carbamoyl]cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 156624697 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | methyl 4-[[(1S,3R)-3-[[4-(formyloxymethyl)phenyl]carbamoyl]cyclohexanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H]2CCC[C@@H](C(=O)Nc3ccc(COC=O)cc3)C2)cc1 |
| InChI | InChI=1S/C24H26N2O6/c1-31-24(30)17-7-11-21(12-8-17)26-23(29)19-4-2-3-18(13-19)22(28)25-20-9-5-16(6-10-20)14-32-15-27/h5-12,15,18-19H,2-4,13-14H2,1H3,(H,25,28)(H,26,29)/t18-,19+/m1/s1 |
| InChIKey | HJIYKTUYCPFVQF-MOPGFXCFSA-N |
| XLogP | 3.53 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|