C9H14O5 — CID 164983071
(1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-6-one (PubChem CID 164983071) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-6-one.
| Compound Name | (1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-6-one |
|---|---|
| PubChem CID | 164983071 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-6-one |
| SMILES | C[C@@]12CC(=O)[C@@](C)(O1)[C@H](O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C9H14O5/c1-8-3-4(10)9(2,14-8)7(13)5(11)6(8)12/h5-7,11-13H,3H2,1-2H3/t5-,6-,7+,8-,9+/m0/s1 |
| InChIKey | FTQNXBCJYMFAPJ-VRGHQRLXSA-N |
| XLogP | -1.41 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |