C15H14N2O2S2 — CID 164983603
4-methyl-N-(2-sulfanylidene-1,3-dihydroindol-6-yl)benzenesulfonamide (PubChem CID 164983603) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-methyl-N-(2-sulfanylidene-1,3-dihydroindol-6-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-sulfanylidene-1,3-dihydroindol-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 164983603 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-methyl-N-(2-sulfanylidene-1,3-dihydroindol-6-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)NC(=S)C3)cc1 |
| InChI | InChI=1S/C15H14N2O2S2/c1-10-2-6-13(7-3-10)21(18,19)17-12-5-4-11-8-15(20)16-14(11)9-12/h2-7,9,17H,8H2,1H3,(H,16,20) |
| InChIKey | FVLXWFPLCFBNND-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|