C12H18F6O4 — CID 164984792
3-(1,1,1,5,5,5-hexafluoro-2-hydroxypentan-2-yl)oxypropyl 2-methylpropanoate (PubChem CID 164984792) has the molecular formula C12H18F6O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is 3-(1,1,1,5,5,5-hexafluoro-2-hydroxypentan-2-yl)oxypropyl 2-methylpropanoate.
| Compound Name | 3-(1,1,1,5,5,5-hexafluoro-2-hydroxypentan-2-yl)oxypropyl 2-methylpropanoate |
|---|---|
| PubChem CID | 164984792 |
| Molecular Formula | C12H18F6O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-(1,1,1,5,5,5-hexafluoro-2-hydroxypentan-2-yl)oxypropyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCOC(O)(CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6O4/c1-8(2)9(19)21-6-3-7-22-10(20,12(16,17)18)4-5-11(13,14)15/h8,20H,3-7H2,1-2H3 |
| InChIKey | FZSDKTQDWAEYBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|